C18H28N4O3S — CID 97348567
(3R)-N-cyclopentyl-1-[2-(dimethylamino)pyridine-3-carbonyl]piperidine-3-sulfonamide (PubChem CID 97348567) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is (3R)-N-cyclopentyl-1-[2-(dimethylamino)pyridine-3-carbonyl]piperidine-3-sulfonamide.
| Compound Name | (3R)-N-cyclopentyl-1-[2-(dimethylamino)pyridine-3-carbonyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348567 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | (3R)-N-cyclopentyl-1-[2-(dimethylamino)pyridine-3-carbonyl]piperidine-3-sulfonamide |
| SMILES | CN(C)c1ncccc1C(=O)N1CCC[C@@H](S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C18H28N4O3S/c1-21(2)17-16(10-5-11-19-17)18(23)22-12-6-9-15(13-22)26(24,25)20-14-7-3-4-8-14/h5,10-11,14-15,20H,3-4,6-9,12-13H2,1-2H3/t15-/m1/s1 |
| InChIKey | ISQFSMUTDAPAPY-OAHLLOKOSA-N |
| XLogP | 1.61 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |