C17H22F3N3O3S — CID 97348547
(3R)-N-cyclopentyl-1-[6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-sulfonamide (PubChem CID 97348547) has the molecular formula C17H22F3N3O3S and a molecular weight of 405.44 g/mol. Its IUPAC name is (3R)-N-cyclopentyl-1-[6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-sulfonamide.
| Compound Name | (3R)-N-cyclopentyl-1-[6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348547 |
| Molecular Formula | C17H22F3N3O3S |
| Molecular Weight | 405.44 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | (3R)-N-cyclopentyl-1-[6-(trifluoromethyl)pyridine-3-carbonyl]piperidine-3-sulfonamide |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1)N1CCC[C@@H](S(=O)(=O)NC2CCCC2)C1 |
| InChI | InChI=1S/C17H22F3N3O3S/c18-17(19,20)15-8-7-12(10-21-15)16(24)23-9-3-6-14(11-23)27(25,26)22-13-4-1-2-5-13/h7-8,10,13-14,22H,1-6,9,11H2/t14-/m1/s1 |
| InChIKey | BKWAZCCZXPUGNC-CQSZACIVSA-N |
| XLogP | 2.57 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |