C16H20F3N3O4S — CID 97343487
[(3S)-3-morpholin-4-ylsulfonylpiperidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 97343487) has the molecular formula C16H20F3N3O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is [(3S)-3-morpholin-4-ylsulfonylpiperidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(3S)-3-morpholin-4-ylsulfonylpiperidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 97343487 |
| Molecular Formula | C16H20F3N3O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | [(3S)-3-morpholin-4-ylsulfonylpiperidin-1-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | O=C(c1ccc(C(F)(F)F)nc1)N1CCC[C@H](S(=O)(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C16H20F3N3O4S/c17-16(18,19)14-4-3-12(10-20-14)15(23)21-5-1-2-13(11-21)27(24,25)22-6-8-26-9-7-22/h3-4,10,13H,1-2,5-9,11H2/t13-/m0/s1 |
| InChIKey | KSQPRPJNVRGBRA-ZDUSSCGKSA-N |
| XLogP | 1.37 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |