C19H24N4O3S — CID 97348370
(3S)-1-[6-(dimethylamino)pyridine-3-carbonyl]-N-phenylpiperidine-3-sulfonamide (PubChem CID 97348370) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is (3S)-1-[6-(dimethylamino)pyridine-3-carbonyl]-N-phenylpiperidine-3-sulfonamide.
| Compound Name | (3S)-1-[6-(dimethylamino)pyridine-3-carbonyl]-N-phenylpiperidine-3-sulfonamide |
|---|---|
| PubChem CID | 97348370 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (3S)-1-[6-(dimethylamino)pyridine-3-carbonyl]-N-phenylpiperidine-3-sulfonamide |
| SMILES | CN(C)c1ccc(C(=O)N2CCC[C@H](S(=O)(=O)Nc3ccccc3)C2)cn1 |
| InChI | InChI=1S/C19H24N4O3S/c1-22(2)18-11-10-15(13-20-18)19(24)23-12-6-9-17(14-23)27(25,26)21-16-7-4-3-5-8-16/h3-5,7-8,10-11,13,17,21H,6,9,12,14H2,1-2H3/t17-/m0/s1 |
| InChIKey | KRHQJVASJYDJCR-KRWDZBQOSA-N |
| XLogP | 2.19 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |