C17H19N3O3S — CID 75476115
N-phenyl-1-(pyridine-2-carbonyl)piperidine-3-sulfonamide (PubChem CID 75476115) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is N-phenyl-1-(pyridine-2-carbonyl)piperidine-3-sulfonamide.
| Compound Name | N-phenyl-1-(pyridine-2-carbonyl)piperidine-3-sulfonamide |
|---|---|
| PubChem CID | 75476115 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-phenyl-1-(pyridine-2-carbonyl)piperidine-3-sulfonamide |
| SMILES | O=C(c1ccccn1)N1CCCC(S(=O)(=O)Nc2ccccc2)C1 |
| InChI | InChI=1S/C17H19N3O3S/c21-17(16-10-4-5-11-18-16)20-12-6-9-15(13-20)24(22,23)19-14-7-2-1-3-8-14/h1-5,7-8,10-11,15,19H,6,9,12-13H2 |
| InChIKey | VRUDVEJUDCZMRG-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |