C14H19NO6S — CID 135090575
(3S,4S)-1-(4-ethoxyphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid (PubChem CID 135090575) has the molecular formula C14H19NO6S and a molecular weight of 329.37 g/mol. Its IUPAC name is (3S,4S)-1-(4-ethoxyphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid.
| Compound Name | (3S,4S)-1-(4-ethoxyphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135090575 |
| Molecular Formula | C14H19NO6S |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (3S,4S)-1-(4-ethoxyphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid |
| SMILES | CCOc1ccc(S(=O)(=O)N2CC[C@H](O)[C@@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C14H19NO6S/c1-2-21-10-3-5-11(6-4-10)22(19,20)15-8-7-13(16)12(9-15)14(17)18/h3-6,12-13,16H,2,7-9H2,1H3,(H,17,18)/t12-,13-/m0/s1 |
| InChIKey | ZOXJJIDWWKECIG-STQMWFEESA-N |
| XLogP | 0.54 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |