C16H23NO5S — CID 135089062
(3S,4R)-1-(4-butylphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid (PubChem CID 135089062) has the molecular formula C16H23NO5S and a molecular weight of 341.43 g/mol. Its IUPAC name is (3S,4R)-1-(4-butylphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid.
| Compound Name | (3S,4R)-1-(4-butylphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 135089062 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (3S,4R)-1-(4-butylphenyl)sulfonyl-4-hydroxypiperidine-3-carboxylic acid |
| SMILES | CCCCc1ccc(S(=O)(=O)N2CC[C@@H](O)[C@@H](C(=O)O)C2)cc1 |
| InChI | InChI=1S/C16H23NO5S/c1-2-3-4-12-5-7-13(8-6-12)23(21,22)17-10-9-15(18)14(11-17)16(19)20/h5-8,14-15,18H,2-4,9-11H2,1H3,(H,19,20)/t14-,15+/m0/s1 |
| InChIKey | XHVBNWLJDVPJHU-LSDHHAIUSA-N |
| XLogP | 1.49 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |