C22H25F3N2O7S — CID 87963227
[(3R,6S)-2,2,6-trimethyl-4-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate (PubChem CID 87963227) has the molecular formula C22H25F3N2O7S and a molecular weight of 518.51 g/mol. Its IUPAC name is [(3R,6S)-2,2,6-trimethyl-4-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate.
| Compound Name | [(3R,6S)-2,2,6-trimethyl-4-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 87963227 |
| Molecular Formula | C22H25F3N2O7S |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | [(3R,6S)-2,2,6-trimethyl-4-[4-[[2-(trifluoromethyl)phenyl]methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate |
| SMILES | C[C@H]1CN(S(=O)(=O)c2ccc(OCc3ccccc3C(F)(F)F)cc2)[C@H](OC(=O)NO)C(C)(C)O1 |
| InChI | InChI=1S/C22H25F3N2O7S/c1-14-12-27(19(21(2,3)34-14)33-20(28)26-29)35(30,31)17-10-8-16(9-11-17)32-13-15-6-4-5-7-18(15)22(23,24)25/h4-11,14,19,29H,12-13H2,1-3H3,(H,26,28)/t14-,19+/m0/s1 |
| InChIKey | KNYWVTQGWJYLEV-IFXJQAMLSA-N |
| XLogP | 3.91 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|