C21H26N2O6S — CID 20712324
1-[4-[(2-ethylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxypiperidine-2-carboxamide (PubChem CID 20712324) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is 1-[4-[(2-ethylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxypiperidine-2-carboxamide.
| Compound Name | 1-[4-[(2-ethylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxypiperidine-2-carboxamide |
|---|---|
| PubChem CID | 20712324 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 1-[4-[(2-ethylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxypiperidine-2-carboxamide |
| SMILES | CCc1ccccc1COc1ccc(S(=O)(=O)N2CC(O)CCC2C(=O)NO)cc1 |
| InChI | InChI=1S/C21H26N2O6S/c1-2-15-5-3-4-6-16(15)14-29-18-8-10-19(11-9-18)30(27,28)23-13-17(24)7-12-20(23)21(25)22-26/h3-6,8-11,17,20,24,26H,2,7,12-14H2,1H3,(H,22,25) |
| InChIKey | XXUCOZXCPFTGGY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|