C20H31N3O7S — CID 10837557
(2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]pyrrolidine-2-carboxamide (PubChem CID 10837557) has the molecular formula C20H31N3O7S and a molecular weight of 457.55 g/mol. Its IUPAC name is (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]pyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10837557 |
| Molecular Formula | C20H31N3O7S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (2R,4S)-1-(4-butoxyphenyl)sulfonyl-N-hydroxy-4-[[(2S)-2-hydroxy-3-methylbutanoyl]amino]pyrrolidine-2-carboxamide |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C[C@@H](NC(=O)[C@@H](O)C(C)C)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C20H31N3O7S/c1-4-5-10-30-15-6-8-16(9-7-15)31(28,29)23-12-14(11-17(23)19(25)22-27)21-20(26)18(24)13(2)3/h6-9,13-14,17-18,24,27H,4-5,10-12H2,1-3H3,(H,21,26)(H,22,25)/t14-,17+,18-/m0/s1 |
| InChIKey | XSMMFHYHIAOGPC-QGTPRVQTSA-N |
| XLogP | 0.64 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|