C16H22ClN5O6S — CID 90656575
(2S,4S)-4-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-1-(4-chlorophenyl)sulfonyl-N-hydroxypyrrolidine-2-carboxamide (PubChem CID 90656575) has the molecular formula C16H22ClN5O6S and a molecular weight of 447.90 g/mol. Its IUPAC name is (2S,4S)-4-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-1-(4-chlorophenyl)sulfonyl-N-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-1-(4-chlorophenyl)sulfonyl-N-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90656575 |
| Molecular Formula | C16H22ClN5O6S |
| Molecular Weight | 447.90 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | (2S,4S)-4-[[2-[[(2S)-2-aminopropanoyl]amino]acetyl]amino]-1-(4-chlorophenyl)sulfonyl-N-hydroxypyrrolidine-2-carboxamide |
| SMILES | C[C@H](N)C(=O)NCC(=O)N[C@H]1C[C@@H](C(=O)NO)N(S(=O)(=O)c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C16H22ClN5O6S/c1-9(18)15(24)19-7-14(23)20-11-6-13(16(25)21-26)22(8-11)29(27,28)12-4-2-10(17)3-5-12/h2-5,9,11,13,26H,6-8,18H2,1H3,(H,19,24)(H,20,23)(H,21,25)/t9-,11-,13-/m0/s1 |
| InChIKey | PHEVWPSNUPXAFQ-GAFUQQFSSA-N |
| XLogP | -1.44 |
| TPSA | 170.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.90 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|