C20H21Cl2N3O7S — CID 70697478
(2R,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-[(2,4-dimethoxybenzoyl)amino]-N-hydroxypyrrolidine-2-carboxamide (PubChem CID 70697478) has the molecular formula C20H21Cl2N3O7S and a molecular weight of 518.38 g/mol. Its IUPAC name is (2R,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-[(2,4-dimethoxybenzoyl)amino]-N-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2R,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-[(2,4-dimethoxybenzoyl)amino]-N-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 70697478 |
| Molecular Formula | C20H21Cl2N3O7S |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 517.05 |
| IUPAC Name | (2R,4R)-1-(3,4-dichlorophenyl)sulfonyl-4-[(2,4-dimethoxybenzoyl)amino]-N-hydroxypyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2C[C@H](C(=O)NO)N(S(=O)(=O)c3ccc(Cl)c(Cl)c3)C2)c(OC)c1 |
| InChI | InChI=1S/C20H21Cl2N3O7S/c1-31-12-3-5-14(18(8-12)32-2)19(26)23-11-7-17(20(27)24-28)25(10-11)33(29,30)13-4-6-15(21)16(22)9-13/h3-6,8-9,11,17,28H,7,10H2,1-2H3,(H,23,26)(H,24,27)/t11-,17-/m1/s1 |
| InChIKey | UCTXPISEYKNHPX-PIGZYNQJSA-N |
| XLogP | 2.08 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|