C17H25N3O7S2 — CID 10742072
(2R,4S)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-hydroxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 10742072) has the molecular formula C17H25N3O7S2 and a molecular weight of 447.54 g/mol. Its IUPAC name is (2R,4S)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-hydroxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R,4S)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-hydroxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 10742072 |
| Molecular Formula | C17H25N3O7S2 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | (2R,4S)-4-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-hydroxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | CCCOc1ccc(S(=O)(=O)N2C[C@@H](N3CCCS3(=O)=O)C[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C17H25N3O7S2/c1-2-9-27-14-4-6-15(7-5-14)29(25,26)20-12-13(11-16(20)17(21)18-22)19-8-3-10-28(19,23)24/h4-7,13,16,22H,2-3,8-12H2,1H3,(H,18,21)/t13-,16+/m0/s1 |
| InChIKey | IWJCPVCPLCTWHT-XJKSGUPXSA-N |
| XLogP | 0.15 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|