C16H23NO8S2 — CID 10740862
methyl (2R,4R)-4-methylsulfonyloxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 10740862) has the molecular formula C16H23NO8S2 and a molecular weight of 421.49 g/mol. Its IUPAC name is methyl (2R,4R)-4-methylsulfonyloxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,4R)-4-methylsulfonyloxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10740862 |
| Molecular Formula | C16H23NO8S2 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | methyl (2R,4R)-4-methylsulfonyloxy-1-(4-propoxyphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | CCCOc1ccc(S(=O)(=O)N2C[C@H](OS(C)(=O)=O)C[C@@H]2C(=O)OC)cc1 |
| InChI | InChI=1S/C16H23NO8S2/c1-4-9-24-12-5-7-14(8-6-12)27(21,22)17-11-13(25-26(3,19)20)10-15(17)16(18)23-2/h5-8,13,15H,4,9-11H2,1-3H3/t13-,15-/m1/s1 |
| InChIKey | TZCFYTAIIRSRGY-UKRRQHHQSA-N |
| XLogP | 0.76 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|