C22H29N3O7S — CID 10600743
methyl (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(2,5-dioxo-3-prop-2-enylimidazolidin-1-yl)pyrrolidine-2-carboxylate (PubChem CID 10600743) has the molecular formula C22H29N3O7S and a molecular weight of 479.56 g/mol. Its IUPAC name is methyl (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(2,5-dioxo-3-prop-2-enylimidazolidin-1-yl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(2,5-dioxo-3-prop-2-enylimidazolidin-1-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10600743 |
| Molecular Formula | C22H29N3O7S |
| Molecular Weight | 479.56 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | methyl (2R,4S)-1-(4-butoxyphenyl)sulfonyl-4-(2,5-dioxo-3-prop-2-enylimidazolidin-1-yl)pyrrolidine-2-carboxylate |
| SMILES | C=CCN1CC(=O)N([C@H]2C[C@H](C(=O)OC)N(S(=O)(=O)c3ccc(OCCCC)cc3)C2)C1=O |
| InChI | InChI=1S/C22H29N3O7S/c1-4-6-12-32-17-7-9-18(10-8-17)33(29,30)24-14-16(13-19(24)21(27)31-3)25-20(26)15-23(11-5-2)22(25)28/h5,7-10,16,19H,2,4,6,11-15H2,1,3H3/t16-,19+/m0/s1 |
| InChIKey | DGRBDJJORCKUOZ-QFBILLFUSA-N |
| XLogP | 1.62 |
| TPSA | 113.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.56 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|