C20H30N4O5S — CID 10550994
methyl (2R,4E)-1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-yliminopyrrolidine-2-carboxylate (PubChem CID 10550994) has the molecular formula C20H30N4O5S and a molecular weight of 438.55 g/mol. Its IUPAC name is methyl (2R,4E)-1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-yliminopyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,4E)-1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-yliminopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10550994 |
| Molecular Formula | C20H30N4O5S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.19 |
| IUPAC Name | methyl (2R,4E)-1-(4-butoxyphenyl)sulfonyl-4-piperazin-1-yliminopyrrolidine-2-carboxylate |
| SMILES | CCCCOc1ccc(S(=O)(=O)N2C/C(=N/N3CCNCC3)C[C@@H]2C(=O)OC)cc1 |
| InChI | InChI=1S/C20H30N4O5S/c1-3-4-13-29-17-5-7-18(8-6-17)30(26,27)24-15-16(14-19(24)20(25)28-2)22-23-11-9-21-10-12-23/h5-8,19,21H,3-4,9-15H2,1-2H3/b22-16+/t19-/m1/s1 |
| InChIKey | LALVLJXPDPTUSW-NDWLXSOOSA-N |
| XLogP | 1.06 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|