C21H25N3O6S — CID 10575412
methyl (2R,4Z)-4-[(2-methylpropan-2-yl)oxyimino]-1-(4-pyridin-4-yloxyphenyl)sulfonylpyrrolidine-2-carboxylate (PubChem CID 10575412) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is methyl (2R,4Z)-4-[(2-methylpropan-2-yl)oxyimino]-1-(4-pyridin-4-yloxyphenyl)sulfonylpyrrolidine-2-carboxylate.
| Compound Name | methyl (2R,4Z)-4-[(2-methylpropan-2-yl)oxyimino]-1-(4-pyridin-4-yloxyphenyl)sulfonylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 10575412 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | methyl (2R,4Z)-4-[(2-methylpropan-2-yl)oxyimino]-1-(4-pyridin-4-yloxyphenyl)sulfonylpyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@H]1C/C(=N/OC(C)(C)C)CN1S(=O)(=O)c1ccc(Oc2ccncc2)cc1 |
| InChI | InChI=1S/C21H25N3O6S/c1-21(2,3)30-23-15-13-19(20(25)28-4)24(14-15)31(26,27)18-7-5-16(6-8-18)29-17-9-11-22-12-10-17/h5-12,19H,13-14H2,1-4H3/b23-15-/t19-/m1/s1 |
| InChIKey | TVUYBSUKVQGVMM-IQJJTXKVSA-N |
| XLogP | 2.98 |
| TPSA | 107.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|