C21H24ClFN2O6S — CID 58619815
(2R,5R)-1-[4-[(5-chloro-2-fluorophenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide (PubChem CID 58619815) has the molecular formula C21H24ClFN2O6S and a molecular weight of 486.95 g/mol. Its IUPAC name is (2R,5R)-1-[4-[(5-chloro-2-fluorophenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide.
| Compound Name | (2R,5R)-1-[4-[(5-chloro-2-fluorophenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 58619815 |
| Molecular Formula | C21H24ClFN2O6S |
| Molecular Weight | 486.95 g/mol |
| Exact Mass | 486.10 |
| IUPAC Name | (2R,5R)-1-[4-[(5-chloro-2-fluorophenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide |
| SMILES | CC1(C)C[C@@H](O)CN(S(=O)(=O)c2ccc(OCc3cc(Cl)ccc3F)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C21H24ClFN2O6S/c1-21(2)10-15(26)11-25(19(21)20(27)24-28)32(29,30)17-6-4-16(5-7-17)31-12-13-9-14(22)3-8-18(13)23/h3-9,15,19,26,28H,10-12H2,1-2H3,(H,24,27)/t15-,19+/m1/s1 |
| InChIKey | XOODFFUDKRERSH-BEFAXECRSA-N |
| XLogP | 2.71 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.95 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|