C15H22N2O8S2 — CID 101400915
(3S)-N,6-dihydroxy-4-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-1,1-dioxo-1,4-thiazepane-3-carboxamide (PubChem CID 101400915) has the molecular formula C15H22N2O8S2 and a molecular weight of 422.48 g/mol. Its IUPAC name is (3S)-N,6-dihydroxy-4-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-1,1-dioxo-1,4-thiazepane-3-carboxamide.
| Compound Name | (3S)-N,6-dihydroxy-4-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-1,1-dioxo-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 101400915 |
| Molecular Formula | C15H22N2O8S2 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | (3S)-N,6-dihydroxy-4-(4-methoxyphenyl)sulfonyl-2,2-dimethyl-1,1-dioxo-1,4-thiazepane-3-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CC(O)CS(=O)(=O)C(C)(C)[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C15H22N2O8S2/c1-15(2)13(14(19)16-20)17(8-10(18)9-26(15,21)22)27(23,24)12-6-4-11(25-3)5-7-12/h4-7,10,13,18,20H,8-9H2,1-3H3,(H,16,19)/t10?,13-/m0/s1 |
| InChIKey | AHBFOOOWLVWQFO-HQVZTVAUSA-N |
| XLogP | -0.87 |
| TPSA | 150.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|