C22H27FN2O6S — CID 22182512
1-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide (PubChem CID 22182512) has the molecular formula C22H27FN2O6S and a molecular weight of 466.53 g/mol. Its IUPAC name is 1-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide.
| Compound Name | 1-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide |
|---|---|
| PubChem CID | 22182512 |
| Molecular Formula | C22H27FN2O6S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | 1-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N,5-dihydroxy-3,3-dimethylpiperidine-2-carboxamide |
| SMILES | Cc1cc(F)ccc1COc1ccc(S(=O)(=O)N2CC(O)CC(C)(C)C2C(=O)NO)cc1 |
| InChI | InChI=1S/C22H27FN2O6S/c1-14-10-16(23)5-4-15(14)13-31-18-6-8-19(9-7-18)32(29,30)25-12-17(26)11-22(2,3)20(25)21(27)24-28/h4-10,17,20,26,28H,11-13H2,1-3H3,(H,24,27) |
| InChIKey | LOMOBWUKCBVLNJ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 116.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|