C21H27N3O6S — CID 57264071
(3R,6S)-N-hydroxy-2,2,6-trimethyl-4-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]sulfonylmorpholine-3-carboxamide (PubChem CID 57264071) has the molecular formula C21H27N3O6S and a molecular weight of 449.53 g/mol. Its IUPAC name is (3R,6S)-N-hydroxy-2,2,6-trimethyl-4-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]sulfonylmorpholine-3-carboxamide.
| Compound Name | (3R,6S)-N-hydroxy-2,2,6-trimethyl-4-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]sulfonylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 57264071 |
| Molecular Formula | C21H27N3O6S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (3R,6S)-N-hydroxy-2,2,6-trimethyl-4-[4-[(2-methyl-3-pyridinyl)methoxy]phenyl]sulfonylmorpholine-3-carboxamide |
| SMILES | Cc1ncccc1COc1ccc(S(=O)(=O)N2C[C@H](C)OC(C)(C)[C@@H]2C(=O)NO)cc1 |
| InChI | InChI=1S/C21H27N3O6S/c1-14-12-24(19(20(25)23-26)21(3,4)30-14)31(27,28)18-9-7-17(8-10-18)29-13-16-6-5-11-22-15(16)2/h5-11,14,19,26H,12-13H2,1-4H3,(H,23,25)/t14-,19-/m0/s1 |
| InChIKey | HHTGGWSSUVIISP-LIRRHRJNSA-N |
| XLogP | 2.03 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|