C21H26N2O7S — CID 87961795
[(2S,3R,6S)-2,6-dimethyl-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate (PubChem CID 87961795) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is [(2S,3R,6S)-2,6-dimethyl-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate.
| Compound Name | [(2S,3R,6S)-2,6-dimethyl-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate |
|---|---|
| PubChem CID | 87961795 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | [(2S,3R,6S)-2,6-dimethyl-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonylmorpholin-3-yl] N-hydroxycarbamate |
| SMILES | Cc1ccccc1COc1ccc(S(=O)(=O)N2C[C@H](C)O[C@@H](C)[C@H]2OC(=O)NO)cc1 |
| InChI | InChI=1S/C21H26N2O7S/c1-14-6-4-5-7-17(14)13-28-18-8-10-19(11-9-18)31(26,27)23-12-15(2)29-16(3)20(23)30-21(24)22-25/h4-11,15-16,20,25H,12-13H2,1-3H3,(H,22,24)/t15-,16-,20+/m0/s1 |
| InChIKey | UEQWPEGMLSFDHW-TWOQFEAHSA-N |
| XLogP | 2.81 |
| TPSA | 114.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|