C20H23NO7S — CID 21354858
N,3-dihydroxy-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonyloxane-3-carboxamide (PubChem CID 21354858) has the molecular formula C20H23NO7S and a molecular weight of 421.47 g/mol. Its IUPAC name is N,3-dihydroxy-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonyloxane-3-carboxamide.
| Compound Name | N,3-dihydroxy-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonyloxane-3-carboxamide |
|---|---|
| PubChem CID | 21354858 |
| Molecular Formula | C20H23NO7S |
| Molecular Weight | 421.47 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N,3-dihydroxy-4-[4-[(2-methylphenyl)methoxy]phenyl]sulfonyloxane-3-carboxamide |
| SMILES | Cc1ccccc1COc1ccc(S(=O)(=O)C2CCOCC2(O)C(=O)NO)cc1 |
| InChI | InChI=1S/C20H23NO7S/c1-14-4-2-3-5-15(14)12-28-16-6-8-17(9-7-16)29(25,26)18-10-11-27-13-20(18,23)19(22)21-24/h2-9,18,23-24H,10-13H2,1H3,(H,21,22) |
| InChIKey | XWNLDJDYIDRBJI-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.47 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|