C20H23FN2O6S — CID 91196880
N-amino-4-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N-hydroxyoxane-3-carboxamide (PubChem CID 91196880) has the molecular formula C20H23FN2O6S and a molecular weight of 438.48 g/mol. Its IUPAC name is N-amino-4-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N-hydroxyoxane-3-carboxamide.
| Compound Name | N-amino-4-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N-hydroxyoxane-3-carboxamide |
|---|---|
| PubChem CID | 91196880 |
| Molecular Formula | C20H23FN2O6S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | N-amino-4-[4-[(4-fluoro-2-methylphenyl)methoxy]phenyl]sulfonyl-N-hydroxyoxane-3-carboxamide |
| SMILES | Cc1cc(F)ccc1COc1ccc(S(=O)(=O)C2CCOCC2C(=O)N(N)O)cc1 |
| InChI | InChI=1S/C20H23FN2O6S/c1-13-10-15(21)3-2-14(13)11-29-16-4-6-17(7-5-16)30(26,27)19-8-9-28-12-18(19)20(24)23(22)25/h2-7,10,18-19,25H,8-9,11-12,22H2,1H3 |
| InChIKey | SWYSBIZQFFVQRG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|