C19H21NO7S — CID 91170376
N,N-dihydroxy-4-[4-(4-methoxyphenyl)phenyl]sulfonyloxane-3-carboxamide (PubChem CID 91170376) has the molecular formula C19H21NO7S and a molecular weight of 407.44 g/mol. Its IUPAC name is N,N-dihydroxy-4-[4-(4-methoxyphenyl)phenyl]sulfonyloxane-3-carboxamide.
| Compound Name | N,N-dihydroxy-4-[4-(4-methoxyphenyl)phenyl]sulfonyloxane-3-carboxamide |
|---|---|
| PubChem CID | 91170376 |
| Molecular Formula | C19H21NO7S |
| Molecular Weight | 407.44 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | N,N-dihydroxy-4-[4-(4-methoxyphenyl)phenyl]sulfonyloxane-3-carboxamide |
| SMILES | COc1ccc(-c2ccc(S(=O)(=O)C3CCOCC3C(=O)N(O)O)cc2)cc1 |
| InChI | InChI=1S/C19H21NO7S/c1-26-15-6-2-13(3-7-15)14-4-8-16(9-5-14)28(24,25)18-10-11-27-12-17(18)19(21)20(22)23/h2-9,17-18,22-23H,10-12H2,1H3 |
| InChIKey | BNCZWLWHVIWCSS-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.44 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|