C18H25FN2O7S — CID 91003195
4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide (PubChem CID 91003195) has the molecular formula C18H25FN2O7S and a molecular weight of 432.47 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide.
| Compound Name | 4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide |
|---|---|
| PubChem CID | 91003195 |
| Molecular Formula | C18H25FN2O7S |
| Molecular Weight | 432.47 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methoxy]piperidin-1-yl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide |
| SMILES | O=C(C1COCCC1S(=O)(=O)N1CCC(OCc2ccc(F)cc2)CC1)N(O)O |
| InChI | InChI=1S/C18H25FN2O7S/c19-14-3-1-13(2-4-14)11-28-15-5-8-20(9-6-15)29(25,26)17-7-10-27-12-16(17)18(22)21(23)24/h1-4,15-17,23-24H,5-12H2 |
| InChIKey | GTAFLRFMUXYTCW-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|