C19H28N2O8S — CID 91558562
N,N-dihydroxy-4-[4-[(2-methoxyphenyl)methoxy]piperidin-1-yl]sulfonyloxane-3-carboxamide (PubChem CID 91558562) has the molecular formula C19H28N2O8S and a molecular weight of 444.51 g/mol. Its IUPAC name is N,N-dihydroxy-4-[4-[(2-methoxyphenyl)methoxy]piperidin-1-yl]sulfonyloxane-3-carboxamide.
| Compound Name | N,N-dihydroxy-4-[4-[(2-methoxyphenyl)methoxy]piperidin-1-yl]sulfonyloxane-3-carboxamide |
|---|---|
| PubChem CID | 91558562 |
| Molecular Formula | C19H28N2O8S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N,N-dihydroxy-4-[4-[(2-methoxyphenyl)methoxy]piperidin-1-yl]sulfonyloxane-3-carboxamide |
| SMILES | COc1ccccc1COC1CCN(S(=O)(=O)C2CCOCC2C(=O)N(O)O)CC1 |
| InChI | InChI=1S/C19H28N2O8S/c1-27-17-5-3-2-4-14(17)12-29-15-6-9-20(10-7-15)30(25,26)18-8-11-28-13-16(18)19(22)21(23)24/h2-5,15-16,18,23-24H,6-13H2,1H3 |
| InChIKey | GLRXKQJFXZLNRI-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 125.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|