2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid

C14H18O4 — CID 113314325

IUPAC2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid
SMILESO=C(O)Cc1ccccc1COC1CCOCC1
InChIInChI=1S/C14H18O4/c15-14(16)9-11-3-1-2-4-12(11)10-18-13-5-7-17-8-6-13/h1-4,13H,5-10H2,(H,15,16)
InChIKeyDEXQYZQNUDVZMA-UHFFFAOYSA-N
MW250.29 g/mol
LogP2.01
Rot. Bonds5

About 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid

2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid (PubChem CID 113314325) has the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. Its IUPAC name is 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid.

Molecular Properties

Compound Name2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid
PubChem CID113314325
Molecular FormulaC14H18O4
Molecular Weight250.29 g/mol
Exact Mass250.12
IUPAC Name2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid
SMILESO=C(O)Cc1ccccc1COC1CCOCC1
InChIInChI=1S/C14H18O4/c15-14(16)9-11-3-1-2-4-12(11)10-18-13-5-7-17-8-6-13/h1-4,13H,5-10H2,(H,15,16)
InChIKeyDEXQYZQNUDVZMA-UHFFFAOYSA-N
XLogP2.01
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.29
LogP ≤ 52.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[4-(oxan-4-yloxymethyl)phenyl]acetic acid
CID 105344934
(E)-3-[2-(oxan-4-yloxymethyl)phenyl]prop-2-enoic acid
CID 109375604
methyl 2-(oxan-4-yloxymethyl)benzoate
CID 81434511
4-phenylmethoxyoxane
CID 66554133
2-[2-fluoro-4-[[2-(oxan-4-yloxymethyl)benzoyl]amino]phenyl]acetic acid
CID 122109590
2-[2-(piperidin-3-yloxymethyl)phenyl]acetic acid
CID 106939316
2-[2-(oxolan-3-yloxy)phenyl]acetic acid
CID 80741380
N'-hydroxy-2-(oxan-4-yloxymethyl)benzenecarboximidamide
CID 61287384
4-[[[2-(oxan-4-yloxymethyl)benzoyl]amino]methyl]benzoic acid
CID 119353331
2-methyl-N-[2-[2-(oxan-4-yloxymethyl)phenyl]ethyl]propan-1-amine
CID 115464442
2-(cyclopentyloxymethyl)benzoic acid
CID 43473147
6-(oxan-4-yloxymethyl)pyridine-2-carboxylic acid
CID 106903338

Frequently Asked Questions

What is the IUPAC name of 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid?
The IUPAC name of 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid (CID 113314325) is 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid.
What is the SMILES notation for 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid?
The canonical SMILES for 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid is O=C(O)Cc1ccccc1COC1CCOCC1.
What is the InChIKey of 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid?
The InChIKey is DEXQYZQNUDVZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O4/c15-14(16)9-11-3-1-2-4-12(11)10-18-13-5-7-17-8-6-13/h1-4,13H,5-10H2,(H,15,16).
What are the key properties of 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid?
2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid has a molecular weight of 250.29 g/mol, XLogP of 2.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(oxan-4-yloxymethyl)phenyl]acetic acid is sourced from PubChem (CID 113314325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).