C19H22N2O7S — CID 91281007
4-[4-[(2,6-dimethyl-4-pyridinyl)oxy]phenyl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide (PubChem CID 91281007) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is 4-[4-[(2,6-dimethyl-4-pyridinyl)oxy]phenyl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide.
| Compound Name | 4-[4-[(2,6-dimethyl-4-pyridinyl)oxy]phenyl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide |
|---|---|
| PubChem CID | 91281007 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 4-[4-[(2,6-dimethyl-4-pyridinyl)oxy]phenyl]sulfonyl-N,N-dihydroxyoxane-3-carboxamide |
| SMILES | Cc1cc(Oc2ccc(S(=O)(=O)C3CCOCC3C(=O)N(O)O)cc2)cc(C)n1 |
| InChI | InChI=1S/C19H22N2O7S/c1-12-9-15(10-13(2)20-12)28-14-3-5-16(6-4-14)29(25,26)18-7-8-27-11-17(18)19(22)21(23)24/h3-6,9-10,17-18,23-24H,7-8,11H2,1-2H3 |
| InChIKey | JZMHXNXJCSAQSO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 126.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|