C14H21NO4S — CID 97168008
(3R,4R)-3-[(4-methoxyphenyl)methyl]-N-methyloxane-4-sulfonamide (PubChem CID 97168008) has the molecular formula C14H21NO4S and a molecular weight of 299.39 g/mol. Its IUPAC name is (3R,4R)-3-[(4-methoxyphenyl)methyl]-N-methyloxane-4-sulfonamide.
| Compound Name | (3R,4R)-3-[(4-methoxyphenyl)methyl]-N-methyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97168008 |
| Molecular Formula | C14H21NO4S |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3R,4R)-3-[(4-methoxyphenyl)methyl]-N-methyloxane-4-sulfonamide |
| SMILES | CNS(=O)(=O)[C@@H]1CCOC[C@H]1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C14H21NO4S/c1-15-20(16,17)14-7-8-19-10-12(14)9-11-3-5-13(18-2)6-4-11/h3-6,12,14-15H,7-10H2,1-2H3/t12-,14-/m1/s1 |
| InChIKey | ZGVIUDCYCYVNOZ-TZMCWYRMSA-N |
| XLogP | 1.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |