C13H18ClNO3S — CID 97168013
(3R,4S)-3-[(3-chlorophenyl)methyl]-N-methyloxane-4-sulfonamide (PubChem CID 97168013) has the molecular formula C13H18ClNO3S and a molecular weight of 303.81 g/mol. Its IUPAC name is (3R,4S)-3-[(3-chlorophenyl)methyl]-N-methyloxane-4-sulfonamide.
| Compound Name | (3R,4S)-3-[(3-chlorophenyl)methyl]-N-methyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97168013 |
| Molecular Formula | C13H18ClNO3S |
| Molecular Weight | 303.81 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (3R,4S)-3-[(3-chlorophenyl)methyl]-N-methyloxane-4-sulfonamide |
| SMILES | CNS(=O)(=O)[C@H]1CCOC[C@H]1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClNO3S/c1-15-19(16,17)13-5-6-18-9-11(13)7-10-3-2-4-12(14)8-10/h2-4,8,11,13,15H,5-7,9H2,1H3/t11-,13+/m1/s1 |
| InChIKey | ZDJQNWJFEQEWJR-YPMHNXCESA-N |
| XLogP | 1.84 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.81 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |