C13H17Cl2NO3S — CID 97167993
(3R,4S)-3-[(3,4-dichlorophenyl)methyl]-N-methyloxane-4-sulfonamide (PubChem CID 97167993) has the molecular formula C13H17Cl2NO3S and a molecular weight of 338.26 g/mol. Its IUPAC name is (3R,4S)-3-[(3,4-dichlorophenyl)methyl]-N-methyloxane-4-sulfonamide.
| Compound Name | (3R,4S)-3-[(3,4-dichlorophenyl)methyl]-N-methyloxane-4-sulfonamide |
|---|---|
| PubChem CID | 97167993 |
| Molecular Formula | C13H17Cl2NO3S |
| Molecular Weight | 338.26 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (3R,4S)-3-[(3,4-dichlorophenyl)methyl]-N-methyloxane-4-sulfonamide |
| SMILES | CNS(=O)(=O)[C@H]1CCOC[C@H]1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H17Cl2NO3S/c1-16-20(17,18)13-4-5-19-8-10(13)6-9-2-3-11(14)12(15)7-9/h2-3,7,10,13,16H,4-6,8H2,1H3/t10-,13+/m1/s1 |
| InChIKey | UMRSSGPRMHGINV-MFKMUULPSA-N |
| XLogP | 2.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.26 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |