C20H22ClFN2O7S — CID 54063565
N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N,6-dihydroxy-6-methyloxane-3-carboxamide (PubChem CID 54063565) has the molecular formula C20H22ClFN2O7S and a molecular weight of 488.92 g/mol. Its IUPAC name is N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N,6-dihydroxy-6-methyloxane-3-carboxamide.
| Compound Name | N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N,6-dihydroxy-6-methyloxane-3-carboxamide |
|---|---|
| PubChem CID | 54063565 |
| Molecular Formula | C20H22ClFN2O7S |
| Molecular Weight | 488.92 g/mol |
| Exact Mass | 488.08 |
| IUPAC Name | N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N,6-dihydroxy-6-methyloxane-3-carboxamide |
| SMILES | CC1(O)CCC(C(=O)N(O)NS(=O)(=O)c2ccc(OCc3ccc(F)cc3Cl)cc2)CO1 |
| InChI | InChI=1S/C20H22ClFN2O7S/c1-20(26)9-8-14(12-31-20)19(25)24(27)23-32(28,29)17-6-4-16(5-7-17)30-11-13-2-3-15(22)10-18(13)21/h2-7,10,14,23,26-27H,8-9,11-12H2,1H3 |
| InChIKey | MBKHTGCMQQOJJZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.92 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|