C20H22ClFN2O6S — CID 89488584
[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino] 3-hydroxy-3-methylpiperidine-2-carboxylate (PubChem CID 89488584) has the molecular formula C20H22ClFN2O6S and a molecular weight of 472.92 g/mol. Its IUPAC name is [[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino] 3-hydroxy-3-methylpiperidine-2-carboxylate.
| Compound Name | [[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino] 3-hydroxy-3-methylpiperidine-2-carboxylate |
|---|---|
| PubChem CID | 89488584 |
| Molecular Formula | C20H22ClFN2O6S |
| Molecular Weight | 472.92 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino] 3-hydroxy-3-methylpiperidine-2-carboxylate |
| SMILES | CC1(O)CCCNC1C(=O)ONS(=O)(=O)c1ccc(OCc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C20H22ClFN2O6S/c1-20(26)9-2-10-23-18(20)19(25)30-24-31(27,28)16-7-5-15(6-8-16)29-12-13-3-4-14(22)11-17(13)21/h3-8,11,18,23-24,26H,2,9-10,12H2,1H3 |
| InChIKey | PIUABONSDRBMQH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.92 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|