C24H22ClFN2O6S — CID 54115933
N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-5-phenyloxolane-3-carboxamide (PubChem CID 54115933) has the molecular formula C24H22ClFN2O6S and a molecular weight of 520.97 g/mol. Its IUPAC name is N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-5-phenyloxolane-3-carboxamide.
| Compound Name | N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-5-phenyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 54115933 |
| Molecular Formula | C24H22ClFN2O6S |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | N-[[4-[(2-chloro-4-fluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-5-phenyloxolane-3-carboxamide |
| SMILES | O=C(C1COC(c2ccccc2)C1)N(O)NS(=O)(=O)c1ccc(OCc2ccc(F)cc2Cl)cc1 |
| InChI | InChI=1S/C24H22ClFN2O6S/c25-22-13-19(26)7-6-17(22)14-33-20-8-10-21(11-9-20)35(31,32)27-28(30)24(29)18-12-23(34-15-18)16-4-2-1-3-5-16/h1-11,13,18,23,27,30H,12,14-15H2 |
| InChIKey | NKILRDRJTMEKHM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|