C21H22F2N2O7S — CID 163772991
(3aS,7aR)-6-[[4-[(2,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxamide (PubChem CID 163772991) has the molecular formula C21H22F2N2O7S and a molecular weight of 484.48 g/mol. Its IUPAC name is (3aS,7aR)-6-[[4-[(2,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxamide.
| Compound Name | (3aS,7aR)-6-[[4-[(2,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 163772991 |
| Molecular Formula | C21H22F2N2O7S |
| Molecular Weight | 484.48 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (3aS,7aR)-6-[[4-[(2,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxy-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(NO)C1C[C@@H]2OCO[C@@H]2CC1NS(=O)(=O)c1ccc(OCc2cc(F)ccc2F)cc1 |
| InChI | InChI=1S/C21H22F2N2O7S/c22-13-1-6-17(23)12(7-13)10-30-14-2-4-15(5-3-14)33(28,29)25-18-9-20-19(31-11-32-20)8-16(18)21(26)24-27/h1-7,16,18-20,25,27H,8-11H2,(H,24,26)/t16?,18?,19-,20+/m0/s1 |
| InChIKey | MIAKRSGYKSFBEX-DXBWTPJFSA-N |
| XLogP | 1.85 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|