C15H14F2N2O5S — CID 72714081
2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxyacetamide (PubChem CID 72714081) has the molecular formula C15H14F2N2O5S and a molecular weight of 372.35 g/mol. Its IUPAC name is 2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxyacetamide.
| Compound Name | 2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 72714081 |
| Molecular Formula | C15H14F2N2O5S |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 2-[[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonylamino]-N-hydroxyacetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(OCc2cc(F)cc(F)c2)cc1)NO |
| InChI | InChI=1S/C15H14F2N2O5S/c16-11-5-10(6-12(17)7-11)9-24-13-1-3-14(4-2-13)25(22,23)18-8-15(20)19-21/h1-7,18,21H,8-9H2,(H,19,20) |
| InChIKey | WVHOOIOSMOLBGZ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|