C19H20F2N2O5S2 — CID 57038179
(2S,3S)-4-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylthiomorpholine-3-carboxamide (PubChem CID 57038179) has the molecular formula C19H20F2N2O5S2 and a molecular weight of 458.51 g/mol. Its IUPAC name is (2S,3S)-4-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylthiomorpholine-3-carboxamide.
| Compound Name | (2S,3S)-4-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylthiomorpholine-3-carboxamide |
|---|---|
| PubChem CID | 57038179 |
| Molecular Formula | C19H20F2N2O5S2 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.08 |
| IUPAC Name | (2S,3S)-4-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2-methylthiomorpholine-3-carboxamide |
| SMILES | C[C@@H]1SCCN(S(=O)(=O)c2ccc(OCc3cc(F)cc(F)c3)cc2)[C@H]1C(=O)NO |
| InChI | InChI=1S/C19H20F2N2O5S2/c1-12-18(19(24)22-25)23(6-7-29-12)30(26,27)17-4-2-16(3-5-17)28-11-13-8-14(20)10-15(21)9-13/h2-5,8-10,12,18,25H,6-7,11H2,1H3,(H,22,24)/t12-,18+/m0/s1 |
| InChIKey | HMXFCAFEDURCCG-KPZWWZAWSA-N |
| XLogP | 2.54 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|