C21H25FN2O6S — CID 85065581
4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2,6,6-trimethylmorpholine-3-carboxamide (PubChem CID 85065581) has the molecular formula C21H25FN2O6S and a molecular weight of 452.50 g/mol. Its IUPAC name is 4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2,6,6-trimethylmorpholine-3-carboxamide.
| Compound Name | 4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2,6,6-trimethylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 85065581 |
| Molecular Formula | C21H25FN2O6S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | 4-[4-[(4-fluorophenyl)methoxy]phenyl]sulfonyl-N-hydroxy-2,6,6-trimethylmorpholine-3-carboxamide |
| SMILES | CC1OC(C)(C)CN(S(=O)(=O)c2ccc(OCc3ccc(F)cc3)cc2)C1C(=O)NO |
| InChI | InChI=1S/C21H25FN2O6S/c1-14-19(20(25)23-26)24(13-21(2,3)30-14)31(27,28)18-10-8-17(9-11-18)29-12-15-4-6-16(22)7-5-15/h4-11,14,19,26H,12-13H2,1-3H3,(H,23,25) |
| InChIKey | FZLDHGPNPRYOQM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|