C18H17F2NO5S — CID 86589674
methyl (2R,3R)-1-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-3-methylaziridine-2-carboxylate (PubChem CID 86589674) has the molecular formula C18H17F2NO5S and a molecular weight of 397.40 g/mol. Its IUPAC name is methyl (2R,3R)-1-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-3-methylaziridine-2-carboxylate.
| Compound Name | methyl (2R,3R)-1-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-3-methylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 86589674 |
| Molecular Formula | C18H17F2NO5S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | methyl (2R,3R)-1-[4-[(3,5-difluorophenyl)methoxy]phenyl]sulfonyl-3-methylaziridine-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](C)N1S(=O)(=O)c1ccc(OCc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C18H17F2NO5S/c1-11-17(18(22)25-2)21(11)27(23,24)16-5-3-15(4-6-16)26-10-12-7-13(19)9-14(20)8-12/h3-9,11,17H,10H2,1-2H3/t11-,17-,21?/m1/s1 |
| InChIKey | FJPYTAVURDGGEL-CWIOKUOJSA-N |
| XLogP | 2.48 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|