C23H21BrFN3O4S — CID 6009917
N-[(Z)-[2-bromo-5-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 6009917) has the molecular formula C23H21BrFN3O4S and a molecular weight of 534.41 g/mol. Its IUPAC name is N-[(Z)-[2-bromo-5-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-[(Z)-[2-bromo-5-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 6009917 |
| Molecular Formula | C23H21BrFN3O4S |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 533.04 |
| IUPAC Name | N-[(Z)-[2-bromo-5-[(4-fluorophenyl)methoxy]phenyl]methylideneamino]-2-[(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(=O)N/N=C\c2cc(OCc3ccc(F)cc3)ccc2Br)cc1 |
| InChI | InChI=1S/C23H21BrFN3O4S/c1-16-2-9-21(10-3-16)33(30,31)27-14-23(29)28-26-13-18-12-20(8-11-22(18)24)32-15-17-4-6-19(25)7-5-17/h2-13,27H,14-15H2,1H3,(H,28,29)/b26-13- |
| InChIKey | IAWJJGUOTDCENY-ZMFRSBBQSA-N |
| XLogP | 3.90 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|