C21H24N2O8S — CID 87888231
methyl 3-[[4-[4-hydroxy-2-(hydroxycarbamoyl)piperidin-1-yl]sulfonylphenoxy]methyl]benzoate (PubChem CID 87888231) has the molecular formula C21H24N2O8S and a molecular weight of 464.50 g/mol. Its IUPAC name is methyl 3-[[4-[4-hydroxy-2-(hydroxycarbamoyl)piperidin-1-yl]sulfonylphenoxy]methyl]benzoate.
| Compound Name | methyl 3-[[4-[4-hydroxy-2-(hydroxycarbamoyl)piperidin-1-yl]sulfonylphenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 87888231 |
| Molecular Formula | C21H24N2O8S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | methyl 3-[[4-[4-hydroxy-2-(hydroxycarbamoyl)piperidin-1-yl]sulfonylphenoxy]methyl]benzoate |
| SMILES | COC(=O)c1cccc(COc2ccc(S(=O)(=O)N3CCC(O)CC3C(=O)NO)cc2)c1 |
| InChI | InChI=1S/C21H24N2O8S/c1-30-21(26)15-4-2-3-14(11-15)13-31-17-5-7-18(8-6-17)32(28,29)23-10-9-16(24)12-19(23)20(25)22-27/h2-8,11,16,19,24,27H,9-10,12-13H2,1H3,(H,22,25) |
| InChIKey | QGPDYDGGUJCGQH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|