C24H28N4O6S — CID 139996622
(6R)-2-tert-butyl-N-hydroxy-3-oxo-5-(4-phenylmethoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-6-carboxamide (PubChem CID 139996622) has the molecular formula C24H28N4O6S and a molecular weight of 500.58 g/mol. Its IUPAC name is (6R)-2-tert-butyl-N-hydroxy-3-oxo-5-(4-phenylmethoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-6-carboxamide.
| Compound Name | (6R)-2-tert-butyl-N-hydroxy-3-oxo-5-(4-phenylmethoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 139996622 |
| Molecular Formula | C24H28N4O6S |
| Molecular Weight | 500.58 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (6R)-2-tert-butyl-N-hydroxy-3-oxo-5-(4-phenylmethoxyphenyl)sulfonyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-6-carboxamide |
| SMILES | CC(C)(C)n1[nH]c2c(c1=O)CN(S(=O)(=O)c1ccc(OCc3ccccc3)cc1)[C@@H](C(=O)NO)C2 |
| InChI | InChI=1S/C24H28N4O6S/c1-24(2,3)28-23(30)19-14-27(21(22(29)26-31)13-20(19)25-28)35(32,33)18-11-9-17(10-12-18)34-15-16-7-5-4-6-8-16/h4-12,21,25,31H,13-15H2,1-3H3,(H,26,29)/t21-/m1/s1 |
| InChIKey | VRBHYLSQRPITJS-OAQYLSRUSA-N |
| XLogP | 2.13 |
| TPSA | 133.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.58 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|