C19H20ClNO6S — CID 18333820
1-[4-[(3-chlorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidine-2-carboxylic acid (PubChem CID 18333820) has the molecular formula C19H20ClNO6S and a molecular weight of 425.89 g/mol. Its IUPAC name is 1-[4-[(3-chlorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidine-2-carboxylic acid.
| Compound Name | 1-[4-[(3-chlorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18333820 |
| Molecular Formula | C19H20ClNO6S |
| Molecular Weight | 425.89 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 1-[4-[(3-chlorophenyl)methoxy]phenyl]sulfonyl-4-hydroxypiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CCN1S(=O)(=O)c1ccc(OCc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20ClNO6S/c20-14-3-1-2-13(10-14)12-27-16-4-6-17(7-5-16)28(25,26)21-9-8-15(22)11-18(21)19(23)24/h1-7,10,15,18,22H,8-9,11-12H2,(H,23,24) |
| InChIKey | XGKLGFYKWREPNO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |