C19H18F3NO6S — CID 18333750
5-hydroxy-1-[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid (PubChem CID 18333750) has the molecular formula C19H18F3NO6S and a molecular weight of 445.42 g/mol. Its IUPAC name is 5-hydroxy-1-[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 5-hydroxy-1-[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18333750 |
| Molecular Formula | C19H18F3NO6S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | 5-hydroxy-1-[4-[(3,4,5-trifluorophenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCC(O)CN1S(=O)(=O)c1ccc(OCc2cc(F)c(F)c(F)c2)cc1 |
| InChI | InChI=1S/C19H18F3NO6S/c20-15-7-11(8-16(21)18(15)22)10-29-13-2-4-14(5-3-13)30(27,28)23-9-12(24)1-6-17(23)19(25)26/h2-5,7-8,12,17,24H,1,6,9-10H2,(H,25,26) |
| InChIKey | HRHJVKPLAKARMS-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|