C25H25NO6S — CID 18333696
4-hydroxy-1-[4-[(2-phenylphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid (PubChem CID 18333696) has the molecular formula C25H25NO6S and a molecular weight of 467.54 g/mol. Its IUPAC name is 4-hydroxy-1-[4-[(2-phenylphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid.
| Compound Name | 4-hydroxy-1-[4-[(2-phenylphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 18333696 |
| Molecular Formula | C25H25NO6S |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.14 |
| IUPAC Name | 4-hydroxy-1-[4-[(2-phenylphenyl)methoxy]phenyl]sulfonylpiperidine-2-carboxylic acid |
| SMILES | O=C(O)C1CC(O)CCN1S(=O)(=O)c1ccc(OCc2ccccc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25NO6S/c27-20-14-15-26(24(16-20)25(28)29)33(30,31)22-12-10-21(11-13-22)32-17-19-8-4-5-9-23(19)18-6-2-1-3-7-18/h1-13,20,24,27H,14-17H2,(H,28,29) |
| InChIKey | HXAMZFYTMPHHJV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |