C16H20N2O5S2 — CID 139930585
2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1,4-thiazepane-3-carboxamide (PubChem CID 139930585) has the molecular formula C16H20N2O5S2 and a molecular weight of 384.48 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1,4-thiazepane-3-carboxamide.
| Compound Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1,4-thiazepane-3-carboxamide |
|---|---|
| PubChem CID | 139930585 |
| Molecular Formula | C16H20N2O5S2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1,4-thiazepane-3-carboxamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C2SCCCNC2C(=O)NO)cc1 |
| InChI | InChI=1S/C16H20N2O5S2/c1-2-3-10-23-12-5-7-13(8-6-12)25(21,22)16-14(15(19)18-20)17-9-4-11-24-16/h5-8,14,16-17,20H,4,9-11H2,1H3,(H,18,19) |
| InChIKey | MRFJHSSKPNYDBS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|