C20H26N2O5S2 — CID 139930615
2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-thia-4-azaspiro[5.5]undecane-5-carboxamide (PubChem CID 139930615) has the molecular formula C20H26N2O5S2 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-thia-4-azaspiro[5.5]undecane-5-carboxamide.
| Compound Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-thia-4-azaspiro[5.5]undecane-5-carboxamide |
|---|---|
| PubChem CID | 139930615 |
| Molecular Formula | C20H26N2O5S2 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 2-(4-but-2-ynoxyphenyl)sulfonyl-N-hydroxy-1-thia-4-azaspiro[5.5]undecane-5-carboxamide |
| SMILES | CC#CCOc1ccc(S(=O)(=O)C2CNC(C(=O)NO)C3(CCCCC3)S2)cc1 |
| InChI | InChI=1S/C20H26N2O5S2/c1-2-3-13-27-15-7-9-16(10-8-15)29(25,26)17-14-21-18(19(23)22-24)20(28-17)11-5-4-6-12-20/h7-10,17-18,21,24H,4-6,11-14H2,1H3,(H,22,23) |
| InChIKey | DGQHNIDYHUVDFI-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|