C17H21NO5S — CID 57164735
cyclohexyl N-(4-but-2-ynoxyphenyl)sulfonylcarbamate (PubChem CID 57164735) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is cyclohexyl N-(4-but-2-ynoxyphenyl)sulfonylcarbamate.
| Compound Name | cyclohexyl N-(4-but-2-ynoxyphenyl)sulfonylcarbamate |
|---|---|
| PubChem CID | 57164735 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | cyclohexyl N-(4-but-2-ynoxyphenyl)sulfonylcarbamate |
| SMILES | CC#CCOc1ccc(S(=O)(=O)NC(=O)OC2CCCCC2)cc1 |
| InChI | InChI=1S/C17H21NO5S/c1-2-3-13-22-14-9-11-16(12-10-14)24(20,21)18-17(19)23-15-7-5-4-6-8-15/h9-12,15H,4-8,13H2,1H3,(H,18,19) |
| InChIKey | BLMSYKYIUNOIEW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|