C19H25NO6 — CID 2944317
N-[4-(4-methoxyphenoxy)but-2-ynyl]cyclohexanamine;oxalic acid (PubChem CID 2944317) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is N-[4-(4-methoxyphenoxy)but-2-ynyl]cyclohexanamine;oxalic acid.
| Compound Name | N-[4-(4-methoxyphenoxy)but-2-ynyl]cyclohexanamine;oxalic acid |
|---|---|
| PubChem CID | 2944317 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | N-[4-(4-methoxyphenoxy)but-2-ynyl]cyclohexanamine;oxalic acid |
| SMILES | COc1ccc(OCC#CCNC2CCCCC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H23NO2.C2H2O4/c1-19-16-9-11-17(12-10-16)20-14-6-5-13-18-15-7-3-2-4-8-15;3-1(4)2(5)6/h9-12,15,18H,2-4,7-8,13-14H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | PSWIKSVFAGMBKN-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|